Products 877-10-1
CAS 877-10-1 is the registry number for 2,3,5,6-Tetrachloro-p-xylene, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g.
1,2,4,5-tetrachloro-3,6-dimethylbenzene (CAS 877-10-1) is a chemical compound with the molecular formula C8H6Cl4 and a molecular weight of 243.9 g/mol. IUPAC name: 1,2,4,5-tetrachloro-3,6-dimethylbenzene. InChIKey: CTSQZGJZQUVGBQ-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl4 |
|---|---|
| Molecular weight | 243.9 g/mol |
| IUPAC name | 1,2,4,5-tetrachloro-3,6-dimethylbenzene |
| InChIKey | CTSQZGJZQUVGBQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1Cl)Cl)C)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
2,3,5,6-Tetrachloro-p-xylene, p-Xylene, 2,3,5,6-tetrachloro-, 1,2,4,5-Tetrachlorodimethylbenzene, Benzene, 1,2,4,5-tetrachloro-3,6-dimethyl-, p-Xylene, 2,3,5,6-tetrachloro-(8CI), Benzene, 1,2,4,5-tetrachloro-3,6-dimethyl-(9CI), CTSQZGJZQUVGBQ-UHFFFAOYSA-N, Tetrachloro-p-xylene, 2,5,6-Tetrachloro-p-xylene, p-Xylene,3,5,6-tetrachloro-