CAS 3883-14-5 is the registry number for 1-Chloro-4-(2,2,2-trichloroethyl)benzene, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
1-chloro-4-(2,2,2-trichloroethyl)benzene (CAS 3883-14-5) is a chemical compound with the molecular formula C8H6Cl4 and a molecular weight of 243.9 g/mol. IUPAC name: 1-chloro-4-(2,2,2-trichloroethyl)benzene. InChIKey: JBAZZQADYIIBMU-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl4 |
|---|---|
| Molecular weight | 243.9 g/mol |
| IUPAC name | 1-chloro-4-(2,2,2-trichloroethyl)benzene |
| InChIKey | JBAZZQADYIIBMU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(Cl)(Cl)Cl)Cl |
Computed by PubChem (NCBI)