CAS 25660-59-7 appears in our catalog under these names: 2-(4H-1,2,4-Triazol-4-yl)aniline, 95%, 2-(4H-1,2,4-Triazol-4-yl)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(1,2,4-triazol-4-yl)aniline (CAS 25660-59-7) is a chemical compound with the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. IUPAC name: 2-(1,2,4-triazol-4-yl)aniline. InChIKey: LPLUBUYWFLUDLT-UHFFFAOYSA-N.
| Molecular formula | C8H8N4 |
|---|---|
| Molecular weight | 160.18 g/mol |
| IUPAC name | 2-(1,2,4-triazol-4-yl)aniline |
| InChIKey | LPLUBUYWFLUDLT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)N2C=NN=C2 |
Computed by PubChem (NCBI)