Products 2569245-87-8
CAS 2569245-87-8 is the registry number for 6-Bromo-5-fluoroquinazolin-4(3H)-one, 98%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 100mg.
6-bromo-5-fluoro-3H-quinazolin-4-one (CAS 2569245-87-8) is a chemical compound with the molecular formula C8H4BrFN2O and a molecular weight of 243.03 g/mol. IUPAC name: 6-bromo-5-fluoro-3H-quinazolin-4-one. InChIKey: ZMTFQQPPOKQAFU-UHFFFAOYSA-N.
| Molecular formula | C8H4BrFN2O |
|---|---|
| Molecular weight | 243.03 g/mol |
| IUPAC name | 6-bromo-5-fluoro-3H-quinazolin-4-one |
| InChIKey | ZMTFQQPPOKQAFU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1N=CNC2=O)F)Br |
Computed by PubChem (NCBI)