Products 256934-83-5
CAS 256934-83-5 is the registry number for A-259745. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(1-methylindol-5-yl)-5-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1,3-oxazole (CAS 256934-83-5) is a chemical compound with the molecular formula C21H22N2O4 and a molecular weight of 366.4 g/mol. IUPAC name: 2-(1-methylindol-5-yl)-5-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1,3-oxazole. InChIKey: VVXYHELHUZGLHK-UHFFFAOYSA-N.
| Molecular formula | C21H22N2O4 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | 2-(1-methylindol-5-yl)-5-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1,3-oxazole |
| InChIKey | VVXYHELHUZGLHK-UHFFFAOYSA-N |
| SMILES | CN1C=CC2=C1C=CC(=C2)C3=NCC(O3)C4=CC(=C(C(=C4)OC)OC)OC |
Computed by PubChem (NCBI)