CAS 25726-04-9 is the registry number for 2-Oxo-2-phenylacetyl chloride, 98%. Offered by: AmBeed. Available pack sizes: 5g.
2-oxo-2-phenylacetyl chloride (CAS 25726-04-9) is a chemical compound with the molecular formula C8H5ClO2 and a molecular weight of 168.57 g/mol. IUPAC name: 2-oxo-2-phenylacetyl chloride. InChIKey: BNGOFPJWZUXKNR-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO2 |
|---|---|
| Molecular weight | 168.57 g/mol |
| IUPAC name | 2-oxo-2-phenylacetyl chloride |
| InChIKey | BNGOFPJWZUXKNR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C(=O)Cl |
Computed by PubChem (NCBI)