Products 2577325-89-2

CAS 2577325-89-2 is the registry number for 4-(1,3-Dimethyl-1H-pyrazolo[3,4-b]pyridin-6-yl)tetrahydro-2H-thiopyran 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(1,3-dimethylpyrazolo[5,4-b]pyridin-6-yl)thiane 1,1-dioxide (CAS 2577325-89-2) is a chemical compound with the molecular formula C13H17N3O2S and a molecular weight of 279.36 g/mol. IUPAC name: 4-(1,3-dimethylpyrazolo[5,4-b]pyridin-6-yl)thiane 1,1-dioxide. InChIKey: RTSFBYPUUYTANL-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17N3O2S
Molecular weight279.36 g/mol
IUPAC name4-(1,3-dimethylpyrazolo[5,4-b]pyridin-6-yl)thiane 1,1-dioxide
InChIKeyRTSFBYPUUYTANL-UHFFFAOYSA-N
SMILESCC1=NN(C2=C1C=CC(=N2)C3CCS(=O)(=O)CC3)C

Computed by PubChem (NCBI)