CAS 2583247-40-7 is the registry number for 4-(1,4-Dimethyl-1H-pyrazolo[3,4-b]pyridin-6-yl)tetrahydro-2H-thiopyran 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(1,4-dimethylpyrazolo[5,4-b]pyridin-6-yl)thiane 1,1-dioxide (CAS 2583247-40-7) is a chemical compound with the molecular formula C13H17N3O2S and a molecular weight of 279.36 g/mol. IUPAC name: 4-(1,4-dimethylpyrazolo[5,4-b]pyridin-6-yl)thiane 1,1-dioxide. InChIKey: IBZDWZUGAOAEEI-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O2S |
|---|---|
| Molecular weight | 279.36 g/mol |
| IUPAC name | 4-(1,4-dimethylpyrazolo[5,4-b]pyridin-6-yl)thiane 1,1-dioxide |
| InChIKey | IBZDWZUGAOAEEI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C=NN2C)C3CCS(=O)(=O)CC3 |
Computed by PubChem (NCBI)