Products 139751-05-6
CAS 139751-05-6 appears in our catalog under these names: Albendazole Impurity 19, Albendazole Impurity 11, O-Desmethyl-O-ethyl Albendazole. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
Ethyl N-(6-propylsulfanyl-1H-benzimidazol-2-yl)carbamate (CAS 139751-05-6) is a chemical compound with the molecular formula C13H17N3O2S and a molecular weight of 279.36 g/mol. IUPAC name: ethyl N-(6-propylsulfanyl-1H-benzimidazol-2-yl)carbamate. InChIKey: BVPQMOQWGJCZGZ-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O2S |
|---|---|
| Molecular weight | 279.36 g/mol |
| IUPAC name | ethyl N-(6-propylsulfanyl-1H-benzimidazol-2-yl)carbamate |
| InChIKey | BVPQMOQWGJCZGZ-UHFFFAOYSA-N |
| SMILES | CCCSC1=CC2=C(C=C1)N=C(N2)NC(=O)OCC |
Computed by PubChem (NCBI)