CAS 1468656-18-9 is the registry number for 3-(((1-Methyl-1H-indazol-3-yl)methyl)amino)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(1-methylindazol-3-yl)methyl]-1,1-dioxothiolan-3-amine (CAS 1468656-18-9) is a chemical compound with the molecular formula C13H17N3O2S and a molecular weight of 279.36 g/mol. IUPAC name: N-[(1-methylindazol-3-yl)methyl]-1,1-dioxothiolan-3-amine. InChIKey: JYLOMDOVZIQRAU-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O2S |
|---|---|
| Molecular weight | 279.36 g/mol |
| IUPAC name | N-[(1-methylindazol-3-yl)methyl]-1,1-dioxothiolan-3-amine |
| InChIKey | JYLOMDOVZIQRAU-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(=N1)CNC3CCS(=O)(=O)C3 |
Computed by PubChem (NCBI)