CAS 25796-04-7 appears in our catalog under these names: 2-Amino-3-(4-bromo-1H-indol-3-yl)propanoic acid, 98+%, 2–Amino–3–(4–bromo–1H–indol–3–yl)propanoic acid. Offered by: AmBeed, GLPBio. Available pack sizes: 100mg.
2-amino-3-(4-bromo-1H-indol-3-yl)propanoic acid (CAS 25796-04-7) is a chemical compound with the molecular formula C11H11BrN2O2 and a molecular weight of 283.12 g/mol. IUPAC name: 2-amino-3-(4-bromo-1H-indol-3-yl)propanoic acid. InChIKey: OFKIVYVSESEHFZ-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2O2 |
|---|---|
| Molecular weight | 283.12 g/mol |
| IUPAC name | 2-amino-3-(4-bromo-1H-indol-3-yl)propanoic acid |
| InChIKey | OFKIVYVSESEHFZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=CN2)CC(C(=O)O)N |
Computed by PubChem (NCBI)