Products 2580090-13-5
CAS 2580090-13-5 is the registry number for (2S)-4-[(benzyloxy)carbonyl]-6-oxopiperazine-2-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(2S)-6-oxo-4-phenylmethoxycarbonylpiperazine-2-carboxylic acid (CAS 2580090-13-5) is a chemical compound with the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. IUPAC name: (2S)-6-oxo-4-phenylmethoxycarbonylpiperazine-2-carboxylic acid. InChIKey: ILOGMQQLZRASIU-JTQLQIEISA-N.
| Molecular formula | C13H14N2O5 |
|---|---|
| Molecular weight | 278.26 g/mol |
| IUPAC name | (2S)-6-oxo-4-phenylmethoxycarbonylpiperazine-2-carboxylic acid |
| InChIKey | ILOGMQQLZRASIU-JTQLQIEISA-N |
| SMILES | C1[C@H](NC(=O)CN1C(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)