Products 2580231-52-1
CAS 2580231-52-1 is the registry number for 3-Amino-1-(tert-butyl)-1H-pyrazole-4-carboxylic acid, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
3-amino-1-tert-butylpyrazole-4-carboxylic acid (CAS 2580231-52-1) is a chemical compound with the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. IUPAC name: 3-amino-1-tert-butylpyrazole-4-carboxylic acid. InChIKey: WAZDZCJDPSTFHV-UHFFFAOYSA-N.
| Molecular formula | C8H13N3O2 |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 3-amino-1-tert-butylpyrazole-4-carboxylic acid |
| InChIKey | WAZDZCJDPSTFHV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C=C(C(=N1)N)C(=O)O |
Computed by PubChem (NCBI)