Products 2581225-34-3

CAS 2581225-34-3 is the registry number for 5-Cyano-3-ethynylpicolinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-cyano-3-ethynylpyridine-2-carboxylic acid (CAS 2581225-34-3) is a chemical compound with the molecular formula C9H4N2O2 and a molecular weight of 172.14 g/mol. IUPAC name: 5-cyano-3-ethynylpyridine-2-carboxylic acid. InChIKey: JLNHEHXDYYFNEE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H4N2O2
Molecular weight172.14 g/mol
IUPAC name5-cyano-3-ethynylpyridine-2-carboxylic acid
InChIKeyJLNHEHXDYYFNEE-UHFFFAOYSA-N
SMILESC#CC1=C(N=CC(=C1)C#N)C(=O)O

Computed by PubChem (NCBI)