CAS 61394-92-1 appears in our catalog under these names: 2,3-Dioxoindoline-5-carbonitrile 95%, 2,3-dihydro-2,3-dioxo-1H-Indole-5-carbonitrile, 95%, 95%, 2,3-Dioxoindoline-5-carbonitrile, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2,3-dioxo-1H-indole-5-carbonitrile (CAS 61394-92-1) is a chemical compound with the molecular formula C9H4N2O2 and a molecular weight of 172.14 g/mol. IUPAC name: 2,3-dioxo-1H-indole-5-carbonitrile. InChIKey: FTNCNIBQOCAFOV-UHFFFAOYSA-N.
| Molecular formula | C9H4N2O2 |
|---|---|
| Molecular weight | 172.14 g/mol |
| IUPAC name | 2,3-dioxo-1H-indole-5-carbonitrile |
| InChIKey | FTNCNIBQOCAFOV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)