CAS 458568-30-4 appears in our catalog under these names: 2,3-Dioxo-2,3-dihydro-1H-indole-6-carbonitrile, 95%, 2,3-Dioxo-2,3-dihydro-1H-indole-6-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,3-dioxo-1H-indole-6-carbonitrile (CAS 458568-30-4) is a chemical compound with the molecular formula C9H4N2O2 and a molecular weight of 172.14 g/mol. IUPAC name: 2,3-dioxo-1H-indole-6-carbonitrile. InChIKey: MVYRNTZGIPPDBF-UHFFFAOYSA-N.
| Molecular formula | C9H4N2O2 |
|---|---|
| Molecular weight | 172.14 g/mol |
| IUPAC name | 2,3-dioxo-1H-indole-6-carbonitrile |
| InChIKey | MVYRNTZGIPPDBF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)NC(=O)C2=O |
Computed by PubChem (NCBI)