Products 2581232-18-8

CAS 2581232-18-8 is the registry number for 3-Chloro-5-cyano-4-methylpicolinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-chloro-5-cyano-4-methylpyridine-2-carboxylic acid (CAS 2581232-18-8) is a chemical compound with the molecular formula C8H5ClN2O2 and a molecular weight of 196.59 g/mol. IUPAC name: 3-chloro-5-cyano-4-methylpyridine-2-carboxylic acid. InChIKey: WYFQWMYQGGHLDO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5ClN2O2
Molecular weight196.59 g/mol
IUPAC name3-chloro-5-cyano-4-methylpyridine-2-carboxylic acid
InChIKeyWYFQWMYQGGHLDO-UHFFFAOYSA-N
SMILESCC1=C(C(=NC=C1C#N)C(=O)O)Cl

Computed by PubChem (NCBI)