Products 25818-89-7
CAS 25818-89-7 appears in our catalog under these names: 4-(4-Oxoquinazolin-3(4h)-yl)butanoic acid, 95%, 4-(4-Oxoquinazolin-3(4H)-yl)butanoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 2,5g.
4-(4-oxoquinazolin-3-yl)butanoic acid (CAS 25818-89-7) is a chemical compound with the molecular formula C12H12N2O3 and a molecular weight of 232.23 g/mol. IUPAC name: 4-(4-oxoquinazolin-3-yl)butanoic acid. InChIKey: YDSMKDAFGDSYPS-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O3 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | 4-(4-oxoquinazolin-3-yl)butanoic acid |
| InChIKey | YDSMKDAFGDSYPS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C=N2)CCCC(=O)O |
Computed by PubChem (NCBI)