CAS 25826-38-4 is the registry number for 3-(2,6-Dimethylphenoxy)-2-butanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-(2,6-dimethylphenoxy)butan-2-one (CAS 25826-38-4) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 3-(2,6-dimethylphenoxy)butan-2-one. InChIKey: AOOWNECAAOZGOK-UHFFFAOYSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | 3-(2,6-dimethylphenoxy)butan-2-one |
| InChIKey | AOOWNECAAOZGOK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)OC(C)C(=O)C |
Computed by PubChem (NCBI)