Products 2586233-04-5
CAS 2586233-04-5 is the registry number for N'-((6-Methoxypyridin-3-yl)methylene)-4-methylbenzenesulfonohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
N-[(Z)-(6-methoxy-3-pyridinyl)methylideneamino]-4-methylbenzenesulfonamide (CAS 2586233-04-5) is a chemical compound with the molecular formula C14H15N3O3S and a molecular weight of 305.35 g/mol. IUPAC name: N-[(Z)-(6-methoxy-3-pyridinyl)methylideneamino]-4-methylbenzenesulfonamide. InChIKey: WLRYQCNVMKXFFD-YBEGLDIGSA-N.
| Molecular formula | C14H15N3O3S |
|---|---|
| Molecular weight | 305.35 g/mol |
| IUPAC name | N-[(Z)-(6-methoxy-3-pyridinyl)methylideneamino]-4-methylbenzenesulfonamide |
| InChIKey | WLRYQCNVMKXFFD-YBEGLDIGSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C\C2=CN=C(C=C2)OC |
Computed by PubChem (NCBI)