Products 893725-53-6

CAS 893725-53-6 is the registry number for 2-{(3-(Morpholin-4-yl)quinoxalin-2-yl)sulfanyl}acetic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

2-(3-morpholin-4-ylquinoxalin-2-yl)sulfanylacetic acid (CAS 893725-53-6) is a chemical compound with the molecular formula C14H15N3O3S and a molecular weight of 305.35 g/mol. IUPAC name: 2-(3-morpholin-4-ylquinoxalin-2-yl)sulfanylacetic acid. InChIKey: AOYDTDGDJYBVTF-UHFFFAOYSA-N.

Identity
Molecular formulaC14H15N3O3S
Molecular weight305.35 g/mol
IUPAC name2-(3-morpholin-4-ylquinoxalin-2-yl)sulfanylacetic acid
InChIKeyAOYDTDGDJYBVTF-UHFFFAOYSA-N
SMILESC1COCCN1C2=NC3=CC=CC=C3N=C2SCC(=O)O

Computed by PubChem (NCBI)