CAS 78659-11-7 appears in our catalog under these names: hCAI/II/IV-IN-28/ 96.48% (existing batch purity), hCAI/II/IV-IN-28, ≥98%, ≥98%. Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
N-[2-(4-sulfamoylphenyl)ethyl]pyridine-2-carboxamide (CAS 78659-11-7) is a chemical compound with the molecular formula C14H15N3O3S and a molecular weight of 305.35 g/mol. IUPAC name: N-[2-(4-sulfamoylphenyl)ethyl]pyridine-2-carboxamide. InChIKey: XWCMPGKTVGOYNP-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O3S |
|---|---|
| Molecular weight | 305.35 g/mol |
| IUPAC name | N-[2-(4-sulfamoylphenyl)ethyl]pyridine-2-carboxamide |
| InChIKey | XWCMPGKTVGOYNP-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(=O)NCCC2=CC=C(C=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)