Products 25877-53-6
CAS 25877-53-6 appears in our catalog under these names: 2-methyl-5-(4-methylphenyl)-1,3,4-oxadiazole, 98%, 2-Methyl-5-(p-tolyl)-1,3,4-oxadiazole, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 5g.
2-methyl-5-(4-methylphenyl)-1,3,4-oxadiazole (CAS 25877-53-6) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: 2-methyl-5-(4-methylphenyl)-1,3,4-oxadiazole. InChIKey: FIYBFWOENIDUSK-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 2-methyl-5-(4-methylphenyl)-1,3,4-oxadiazole |
| InChIKey | FIYBFWOENIDUSK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NN=C(O2)C |
Computed by PubChem (NCBI)