CAS 258831-35-5 is the registry number for 3-(6,6-Dimethyl-4-oxo-4,5,6,7-tetrahydro-1H-indol-3-yl)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
3-(6,6-dimethyl-4-oxo-5,7-dihydro-1H-indol-3-yl)propanoic acid (CAS 258831-35-5) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: 3-(6,6-dimethyl-4-oxo-5,7-dihydro-1H-indol-3-yl)propanoic acid. InChIKey: PHYVDXWRCVNXTP-UHFFFAOYSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | 3-(6,6-dimethyl-4-oxo-5,7-dihydro-1H-indol-3-yl)propanoic acid |
| InChIKey | PHYVDXWRCVNXTP-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C(=O)C1)C(=CN2)CCC(=O)O)C |
Computed by PubChem (NCBI)