CAS 25888-99-7 appears in our catalog under these names: 1–(4–Methanesulfonylphenyl)ethan–1–ol, 1-(4-Methanesulfonylphenyl)ethan-1-ol, 95%, 95%, 1-(4-Methanesulfonylphenyl)ethan-1-ol, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(4-methylsulfonylphenyl)ethanol (CAS 25888-99-7) is a chemical compound with the molecular formula C9H12O3S and a molecular weight of 200.26 g/mol. IUPAC name: 1-(4-methylsulfonylphenyl)ethanol. InChIKey: NYXCSMWVRWOPJP-UHFFFAOYSA-N.
| Molecular formula | C9H12O3S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | 1-(4-methylsulfonylphenyl)ethanol |
| InChIKey | NYXCSMWVRWOPJP-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)S(=O)(=O)C)O |
Computed by PubChem (NCBI)