Products 25901-27-3
CAS 25901-27-3 appears in our catalog under these names: 4-((3-Nitrophenyl)carbamoyl)butanoic acid, 4-[(3-Nitrophenyl)carbamoyl]butanoic acid, 95%, 5-((3-Nitrophenyl)amino)-5-oxopentanoic acid, 95+%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 5g, 0,5g, 1g, 10g, 250mg, 100mg.
5-(3-nitroanilino)-5-oxopentanoic acid (CAS 25901-27-3) is a chemical compound with the molecular formula C11H12N2O5 and a molecular weight of 252.22 g/mol. IUPAC name: 5-(3-nitroanilino)-5-oxopentanoic acid. InChIKey: NZLOFCLTCZFBJU-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O5 |
|---|---|
| Molecular weight | 252.22 g/mol |
| IUPAC name | 5-(3-nitroanilino)-5-oxopentanoic acid |
| InChIKey | NZLOFCLTCZFBJU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])NC(=O)CCCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3'-nitroglutaranilic acid, 4-[(3-nitrophenyl)carbamoyl]butanoic Acid, 5-(3-nitroanilino)-5-oxopentanoic acid, 5-((3-Nitrophenyl)amino)-5-oxopentanoic acid, 5-[(3-nitrophenyl)amino]-5-oxopentanoic acid, 5-(3-Nitroanilino)-5-oxo-pentanoic acid, 4-[N-(3-nitrophenyl)carbamoyl]butanoic acid, Cambridge id 5259628, Oprea1_761157, 5-((3-Nitrophenyl)amino)-5-oxopentanoicacid