CAS 17376-42-0 appears in our catalog under these names: 4-Nitrophenyl morpholine-4-carboxylate, 95%, 4-Nitrophenyl morpholine-4-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(4-nitrophenyl) morpholine-4-carboxylate (CAS 17376-42-0) is a chemical compound with the molecular formula C11H12N2O5 and a molecular weight of 252.22 g/mol. IUPAC name: (4-nitrophenyl) morpholine-4-carboxylate. InChIKey: JPGDRZRANAJCIM-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O5 |
|---|---|
| Molecular weight | 252.22 g/mol |
| IUPAC name | (4-nitrophenyl) morpholine-4-carboxylate |
| InChIKey | JPGDRZRANAJCIM-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)