CAS 1263818-07-0 is the registry number for 4-Acetylamino-3-methyl-5-nitro-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g.
Methyl 4-acetamido-3-methyl-5-nitrobenzoate (CAS 1263818-07-0) is a chemical compound with the molecular formula C11H12N2O5 and a molecular weight of 252.22 g/mol. IUPAC name: methyl 4-acetamido-3-methyl-5-nitrobenzoate. InChIKey: BURRVTIEEYTFOA-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O5 |
|---|---|
| Molecular weight | 252.22 g/mol |
| IUPAC name | methyl 4-acetamido-3-methyl-5-nitrobenzoate |
| InChIKey | BURRVTIEEYTFOA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1NC(=O)C)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)