CAS 259200-30-1 appears in our catalog under these names: (2R,3S)–Brassinazole, (2R,3S)-Brassinazole, 99%, 99%, (2R,3S)-Brassinazole, 99.83%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 1mg, 10 mg, 5 mg, 10mM/1mL.
(2R,3S)-4-(4-chlorophenyl)-2-phenyl-3-(1,2,4-triazol-1-yl)butan-2-ol (CAS 259200-30-1) is a chemical compound with the molecular formula C18H18ClN3O and a molecular weight of 327.8 g/mol. IUPAC name: (2R,3S)-4-(4-chlorophenyl)-2-phenyl-3-(1,2,4-triazol-1-yl)butan-2-ol. InChIKey: YULDTPKHZNKFEY-ZWKOTPCHSA-N.
| Molecular formula | C18H18ClN3O |
|---|---|
| Molecular weight | 327.8 g/mol |
| IUPAC name | (2R,3S)-4-(4-chlorophenyl)-2-phenyl-3-(1,2,4-triazol-1-yl)butan-2-ol |
| InChIKey | YULDTPKHZNKFEY-ZWKOTPCHSA-N |
| SMILES | C[C@@](C1=CC=CC=C1)([C@H](CC2=CC=C(C=C2)Cl)N3C=NC=N3)O |
Computed by PubChem (NCBI)