CAS 259252-13-6 appears in our catalog under these names: 5-Fluoro-3-hydroxy-2,3-dihydro-1H-indol-2-one, 95%, 5-Fluoro-3-hydroxy-2,3-dihydro-1H-indol-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
5-fluoro-3-hydroxy-1,3-dihydroindol-2-one (CAS 259252-13-6) is a chemical compound with the molecular formula C8H6FNO2 and a molecular weight of 167.14 g/mol. IUPAC name: 5-fluoro-3-hydroxy-1,3-dihydroindol-2-one. InChIKey: XYDTZHMQTYEJQN-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO2 |
|---|---|
| Molecular weight | 167.14 g/mol |
| IUPAC name | 5-fluoro-3-hydroxy-1,3-dihydroindol-2-one |
| InChIKey | XYDTZHMQTYEJQN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(C(=O)N2)O |
Computed by PubChem (NCBI)