Products 25931-47-9

CAS 25931-47-9 is the registry number for L-Lysine, N6-[(phenylmethoxy)carbonyl]-, homopolymer. Offered by: Chemat. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-amino-6-(phenylmethoxycarbonylamino)hexanoic acid (CAS 25931-47-9) is a chemical compound with the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. IUPAC name: 2-amino-6-(phenylmethoxycarbonylamino)hexanoic acid. InChIKey: CKGCFBNYQJDIGS-UHFFFAOYSA-N.

Identity
Molecular formulaC14H20N2O4
Molecular weight280.32 g/mol
IUPAC name2-amino-6-(phenylmethoxycarbonylamino)hexanoic acid
InChIKeyCKGCFBNYQJDIGS-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC(=O)NCCCCC(C(=O)O)N

Computed by PubChem (NCBI)