Products 25962-68-9
CAS 25962-68-9 appears in our catalog under these names: 2-Chloro-n-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide, 95%, 2-Chloro-N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 2,5g.
2-chloro-N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide (CAS 25962-68-9) is a chemical compound with the molecular formula C10H8ClN3OS and a molecular weight of 253.71 g/mol. IUPAC name: 2-chloro-N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide. InChIKey: DSELUSKAJCJQHM-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3OS |
|---|---|
| Molecular weight | 253.71 g/mol |
| IUPAC name | 2-chloro-N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide |
| InChIKey | DSELUSKAJCJQHM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NSC(=N2)NC(=O)CCl |
Computed by PubChem (NCBI)