Products 872101-42-3
CAS 872101-42-3 is the registry number for 4-Chloro-N-(4-methylthiazol-2-yl)picolinamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-N-(4-methyl-1,3-thiazol-2-yl)pyridine-2-carboxamide (CAS 872101-42-3) is a chemical compound with the molecular formula C10H8ClN3OS and a molecular weight of 253.71 g/mol. IUPAC name: 4-chloro-N-(4-methyl-1,3-thiazol-2-yl)pyridine-2-carboxamide. InChIKey: WVUNCLPOMLJBGL-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3OS |
|---|---|
| Molecular weight | 253.71 g/mol |
| IUPAC name | 4-chloro-N-(4-methyl-1,3-thiazol-2-yl)pyridine-2-carboxamide |
| InChIKey | WVUNCLPOMLJBGL-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)NC(=O)C2=NC=CC(=C2)Cl |
Computed by PubChem (NCBI)