Products 885268-36-0
CAS 885268-36-0 is the registry number for 2-Chloro-N-(5-phenyl-1,2,4-thiadiazol-3-yl)acetamide. Offered by: Biosynth. Available pack sizes: 2,5g.
2-chloro-N-(5-phenyl-1,2,4-thiadiazol-3-yl)acetamide (CAS 885268-36-0) is a chemical compound with the molecular formula C10H8ClN3OS and a molecular weight of 253.71 g/mol. IUPAC name: 2-chloro-N-(5-phenyl-1,2,4-thiadiazol-3-yl)acetamide. InChIKey: VUNFVGABWSAHLZ-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3OS |
|---|---|
| Molecular weight | 253.71 g/mol |
| IUPAC name | 2-chloro-N-(5-phenyl-1,2,4-thiadiazol-3-yl)acetamide |
| InChIKey | VUNFVGABWSAHLZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NS2)NC(=O)CCl |
Computed by PubChem (NCBI)