Products 2598814-35-6
CAS 2598814-35-6 is the registry number for 3-Bromo-5-chloro-6'-methyl-2,3'-bipyridine, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-bromo-5-chloro-2-(6-methyl-3-pyridinyl)pyridine (CAS 2598814-35-6) is a chemical compound with the molecular formula C11H8BrClN2 and a molecular weight of 283.55 g/mol. IUPAC name: 3-bromo-5-chloro-2-(6-methyl-3-pyridinyl)pyridine. InChIKey: SXCRVDARHMBTIS-UHFFFAOYSA-N.
| Molecular formula | C11H8BrClN2 |
|---|---|
| Molecular weight | 283.55 g/mol |
| IUPAC name | 3-bromo-5-chloro-2-(6-methyl-3-pyridinyl)pyridine |
| InChIKey | SXCRVDARHMBTIS-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C=C1)C2=C(C=C(C=N2)Cl)Br |
Computed by PubChem (NCBI)