CAS 260046-19-3 appears in our catalog under these names: 2-Chloro-N-methyl-N-phenylpyrimidin-4-amine, 95%, 2-Chloro-N-methyl-N-phenylpyrimidin-4-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-chloro-N-methyl-N-phenylpyrimidin-4-amine (CAS 260046-19-3) is a chemical compound with the molecular formula C11H10ClN3 and a molecular weight of 219.67 g/mol. IUPAC name: 2-chloro-N-methyl-N-phenylpyrimidin-4-amine. InChIKey: PUMAAXYNFYHIAT-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3 |
|---|---|
| Molecular weight | 219.67 g/mol |
| IUPAC name | 2-chloro-N-methyl-N-phenylpyrimidin-4-amine |
| InChIKey | PUMAAXYNFYHIAT-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=CC=C1)C2=NC(=NC=C2)Cl |
Computed by PubChem (NCBI)