CAS 29416-86-2 appears in our catalog under these names: 2-Aminoperimidine hydrochloride, 2-Aminoperimidine hydrochloride, 95%, 1H-perimidin-2-amine hydrochloride, 98%, 1H-Perimidin-2-amine hydrochloride, 95%, 1H-Perimidin-2-amine Hydrochloride, 98%, 98%. Offered by: Biosynth, Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 0,025kg, 0,01kg, 0,05kg, 0,1kg, 1g, 25g, 10g, 5g.
1H-perimidin-2-amine;hydrochloride (CAS 29416-86-2) is a chemical compound with the molecular formula C11H10ClN3 and a molecular weight of 219.67 g/mol. IUPAC name: 1H-perimidin-2-amine;hydrochloride. InChIKey: SZOJMCCLOONRGD-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3 |
|---|---|
| Molecular weight | 219.67 g/mol |
| IUPAC name | 1H-perimidin-2-amine;hydrochloride |
| InChIKey | SZOJMCCLOONRGD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)NC(=NC3=CC=C2)N.Cl |
Computed by PubChem (NCBI)