CAS 426829-61-0 appears in our catalog under these names: N-Benzyl-6-chloropyrazin-2-amine, 95%, N–Benzyl–6–chloropyrazin–2–amine, N-Benzyl-6-chloropyrazin-2-amine 95%, N-Benzyl-6-chloropyrazin-2-amine, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
N-benzyl-6-chloropyrazin-2-amine (CAS 426829-61-0) is a chemical compound with the molecular formula C11H10ClN3 and a molecular weight of 219.67 g/mol. IUPAC name: N-benzyl-6-chloropyrazin-2-amine. InChIKey: HPWNUTJQNSNNAA-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3 |
|---|---|
| Molecular weight | 219.67 g/mol |
| IUPAC name | N-benzyl-6-chloropyrazin-2-amine |
| InChIKey | HPWNUTJQNSNNAA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=CN=CC(=N2)Cl |
Computed by PubChem (NCBI)