CAS 260359-57-7 is the registry number for Bioallethrin. Offered by: Dr. Ehrenstorfer. Available pack sizes: 250mg.
Bioallethrin is a partly enantiopure variant of allethrin consisting of a mixture of two allethrin isomers (1R,trans;1R and 1R,trans;1S) in an approximate ratio of 1:1. Widely registered mosquito adulticide and spatial repellent. Bioallethrin is a synthetic pyrethroid used as a pesticide against household pest insects such as mosquitoes, houseflies and cockroaches.
Source: ChEBI
| Molecular formula | C19H26O3 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | cis-(2-methyl-4-oxo-3-prop-2-enylcyclopent-2-en-1-yl) (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
| InChIKey | ZCVAOQKBXKSDMS-AQYZNVCMSA-N |
| SMILES | CC1=C(C(=O)CC1OC(=O)[C@@H]2[C@H](C2(C)C)C=C(C)C)CC=C |
Computed by PubChem (NCBI)