Products 26057-70-5
CAS 26057-70-5 appears in our catalog under these names: Avenaciolide, Avenaciolid. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 2,5mg, 500μg, 1mg, 5mg, 10mg, Get quote.
(3aS,4S,6aS)-3-methylidene-4-octyl-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione (CAS 26057-70-5) is a chemical compound with the molecular formula C15H22O4 and a molecular weight of 266.33 g/mol. IUPAC name: (3aS,4S,6aS)-3-methylidene-4-octyl-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione. InChIKey: GSTQYRQXFPSWSH-AVGNSLFASA-N.
| Molecular formula | C15H22O4 |
|---|---|
| Molecular weight | 266.33 g/mol |
| IUPAC name | (3aS,4S,6aS)-3-methylidene-4-octyl-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione |
| InChIKey | GSTQYRQXFPSWSH-AVGNSLFASA-N |
| SMILES | CCCCCCCC[C@H]1[C@H]2[C@@H](C(=O)O1)OC(=O)C2=C |
Computed by PubChem (NCBI)