Products 2606032-80-6

CAS 2606032-80-6 is the registry number for LIQ1. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 25 mg.

Structural formula: {0} (CAS {1})

2-(7-hydroxy-4-oxo-2,3-dihydrochromen-2-yl)benzoic acid (CAS 2606032-80-6) is a chemical compound with the molecular formula C16H12O5 and a molecular weight of 284.26 g/mol. IUPAC name: 2-(7-hydroxy-4-oxo-2,3-dihydrochromen-2-yl)benzoic acid. InChIKey: CRQAOKDMEJPZTH-UHFFFAOYSA-N.

Identity
Molecular formulaC16H12O5
Molecular weight284.26 g/mol
IUPAC name2-(7-hydroxy-4-oxo-2,3-dihydrochromen-2-yl)benzoic acid
InChIKeyCRQAOKDMEJPZTH-UHFFFAOYSA-N
SMILESC1C(OC2=C(C1=O)C=CC(=C2)O)C3=CC=CC=C3C(=O)O

Computed by PubChem (NCBI)

Synonyms: orb3174566