Products 2606946-13-6

CAS 2606946-13-6 is the registry number for 4-Bromo-3,3-dimethylindoline-6-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-bromo-3,3-dimethyl-1,2-dihydroindole-6-carboxylic acid (CAS 2606946-13-6) is a chemical compound with the molecular formula C11H12BrNO2 and a molecular weight of 270.12 g/mol. IUPAC name: 4-bromo-3,3-dimethyl-1,2-dihydroindole-6-carboxylic acid. InChIKey: JIIDYXMYIGNCRB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12BrNO2
Molecular weight270.12 g/mol
IUPAC name4-bromo-3,3-dimethyl-1,2-dihydroindole-6-carboxylic acid
InChIKeyJIIDYXMYIGNCRB-UHFFFAOYSA-N
SMILESCC1(CNC2=C1C(=CC(=C2)C(=O)O)Br)C

Computed by PubChem (NCBI)