CAS 2606946-13-6 is the registry number for 4-Bromo-3,3-dimethylindoline-6-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-3,3-dimethyl-1,2-dihydroindole-6-carboxylic acid (CAS 2606946-13-6) is a chemical compound with the molecular formula C11H12BrNO2 and a molecular weight of 270.12 g/mol. IUPAC name: 4-bromo-3,3-dimethyl-1,2-dihydroindole-6-carboxylic acid. InChIKey: JIIDYXMYIGNCRB-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO2 |
|---|---|
| Molecular weight | 270.12 g/mol |
| IUPAC name | 4-bromo-3,3-dimethyl-1,2-dihydroindole-6-carboxylic acid |
| InChIKey | JIIDYXMYIGNCRB-UHFFFAOYSA-N |
| SMILES | CC1(CNC2=C1C(=CC(=C2)C(=O)O)Br)C |
Computed by PubChem (NCBI)