CAS 2607-52-5 appears in our catalog under these names: Everolimus Related Compound 5, Everolimus Impurity 34. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-ditert-butyl-4-methylidenecyclohexa-2,5-dien-1-one (CAS 2607-52-5) is a chemical compound with the molecular formula C15H22O and a molecular weight of 218.33 g/mol. IUPAC name: 2,6-ditert-butyl-4-methylidenecyclohexa-2,5-dien-1-one. InChIKey: JJQCWPWUHZFKBN-UHFFFAOYSA-N.
| Molecular formula | C15H22O |
|---|---|
| Molecular weight | 218.33 g/mol |
| IUPAC name | 2,6-ditert-butyl-4-methylidenecyclohexa-2,5-dien-1-one |
| InChIKey | JJQCWPWUHZFKBN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C)C=C(C1=O)C(C)(C)C |
Computed by PubChem (NCBI)