CAS 261165-15-5 is the registry number for Boc-L-Phe(2,6-Cl2)-OH. Offered by: Iris Biotech. Available pack sizes: 50mg, 250mg.
(2S)-3-(2,6-dichlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 261165-15-5) is a chemical compound with the molecular formula C14H17Cl2NO4 and a molecular weight of 334.2 g/mol. IUPAC name: (2S)-3-(2,6-dichlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: YBKLZYRUNSCPAT-NSHDSACASA-N.
| Molecular formula | C14H17Cl2NO4 |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | (2S)-3-(2,6-dichlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | YBKLZYRUNSCPAT-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=C(C=CC=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)