CAS 26117-15-7 appears in our catalog under these names: D-Carglumic Acid, D-Carglumic Acid (N-Carbamoyl-D-glutamic acid). Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-(carbamoylamino)pentanedioic acid (CAS 26117-15-7) is a chemical compound with the molecular formula C6H10N2O5 and a molecular weight of 190.15 g/mol. IUPAC name: (2R)-2-(carbamoylamino)pentanedioic acid. InChIKey: LCQLHJZYVOQKHU-GSVOUGTGSA-N.
| Molecular formula | C6H10N2O5 |
|---|---|
| Molecular weight | 190.15 g/mol |
| IUPAC name | (2R)-2-(carbamoylamino)pentanedioic acid |
| InChIKey | LCQLHJZYVOQKHU-GSVOUGTGSA-N |
| SMILES | C(CC(=O)O)[C@H](C(=O)O)NC(=O)N |
Computed by PubChem (NCBI)