Products 327065-40-7

CAS 327065-40-7 is the registry number for 4-(2-(Methoxycarbonyl)hydrazinyl)-4-oxobutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(2-methoxycarbonylhydrazinyl)-4-oxobutanoic acid (CAS 327065-40-7) is a chemical compound with the molecular formula C6H10N2O5 and a molecular weight of 190.15 g/mol. IUPAC name: 4-(2-methoxycarbonylhydrazinyl)-4-oxobutanoic acid. InChIKey: MIQCCWBQWYWUKG-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10N2O5
Molecular weight190.15 g/mol
IUPAC name4-(2-methoxycarbonylhydrazinyl)-4-oxobutanoic acid
InChIKeyMIQCCWBQWYWUKG-UHFFFAOYSA-N
SMILESCOC(=O)NNC(=O)CCC(=O)O

Computed by PubChem (NCBI)