Products 96565-32-1
CAS 96565-32-1 is the registry number for Dealanylalahopcin. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-amino-3-(hydroxycarbamoyl)-5-oxopentanoic acid (CAS 96565-32-1) is a chemical compound with the molecular formula C6H10N2O5 and a molecular weight of 190.15 g/mol. IUPAC name: 2-amino-3-(hydroxycarbamoyl)-5-oxopentanoic acid. InChIKey: MPBZRCYIZWWVPG-UHFFFAOYSA-N.
| Molecular formula | C6H10N2O5 |
|---|---|
| Molecular weight | 190.15 g/mol |
| IUPAC name | 2-amino-3-(hydroxycarbamoyl)-5-oxopentanoic acid |
| InChIKey | MPBZRCYIZWWVPG-UHFFFAOYSA-N |
| SMILES | C(C=O)C(C(C(=O)O)N)C(=O)NO |
Computed by PubChem (NCBI)