CAS 2615-11-4 appears in our catalog under these names: 4-Acetylphenyl ether, 98%, 4,4'-Diacetyldiphenyl ether, min. 95 %, 250 g, 1,1'-(Oxybis(4,1-phenylene))diethanone, 98%, 4,4'-Diacetyldiphenyl ether, 1,1′-(Oxydi-4,1-phenylene)bis[ethanone], ≥98%, ≥98%. Offered by: Combi-blocks, Roth, AmBeed, Biosynth, Chemat. Available pack sizes: 25g, 5g, 10g, 1g, 250g, 100g, 50g, 500g.
1-[4-(4-acetylphenoxy)phenyl]ethanone (CAS 2615-11-4) is a chemical compound with the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. IUPAC name: 1-[4-(4-acetylphenoxy)phenyl]ethanone. InChIKey: GZRGHDIUPMPHCB-UHFFFAOYSA-N.
| Molecular formula | C16H14O3 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | 1-[4-(4-acetylphenoxy)phenyl]ethanone |
| InChIKey | GZRGHDIUPMPHCB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)OC2=CC=C(C=C2)C(=O)C |
Computed by PubChem (NCBI)