CAS 261503-40-6 is the registry number for 3H,3H-Perfluorooctane-2,4-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1,1,1,5,5,6,6,7,7,8,8,8-dodecafluorooctane-2,4-dione (CAS 261503-40-6) is a chemical compound with the molecular formula C8H2F12O2 and a molecular weight of 358.08 g/mol. IUPAC name: 1,1,1,5,5,6,6,7,7,8,8,8-dodecafluorooctane-2,4-dione. InChIKey: WNIYZRDLOGYCIO-UHFFFAOYSA-N.
| Molecular formula | C8H2F12O2 |
|---|---|
| Molecular weight | 358.08 g/mol |
| IUPAC name | 1,1,1,5,5,6,6,7,7,8,8,8-dodecafluorooctane-2,4-dione |
| InChIKey | WNIYZRDLOGYCIO-UHFFFAOYSA-N |
| SMILES | C(C(=O)C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)