CAS 872398-78-2 is the registry number for 2H-Perfluoro-(1,2-13C2)-2-Octenoic Acid. Offered by: TRC. Available pack sizes: 10mg.
3,4,4,5,5,6,6,7,7,8,8,8-dodecafluoro(1,2-13C2)oct-2-enoic acid (CAS 872398-78-2) is a chemical compound with the molecular formula C8H2F12O2 and a molecular weight of 360.07 g/mol. IUPAC name: 3,4,4,5,5,6,6,7,7,8,8,8-dodecafluoro(1,2-13C2)oct-2-enoic acid. InChIKey: BKOBFLVYTXYFQZ-ZKDXJZICSA-N.
| Molecular formula | C8H2F12O2 |
|---|---|
| Molecular weight | 360.07 g/mol |
| IUPAC name | 3,4,4,5,5,6,6,7,7,8,8,8-dodecafluoro(1,2-13C2)oct-2-enoic acid |
| InChIKey | BKOBFLVYTXYFQZ-ZKDXJZICSA-N |
| SMILES | [13CH](=C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)F)[13C](=O)O |
Computed by PubChem (NCBI)